C23H23ClN2O9S — CID 4853073
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate (PubChem CID 4853073) has the molecular formula C23H23ClN2O9S and a molecular weight of 538.96 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 4853073 |
| Molecular Formula | C23H23ClN2O9S |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 2-[(4-chlorophenyl)sulfonylamino]-3-hydroxybutanoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)C(NS(=O)(=O)c3ccc(Cl)cc3)C(C)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H23ClN2O9S/c1-3-33-23(30)25-16-6-9-18-14(10-20(28)35-19(18)11-16)12-34-22(29)21(13(2)27)26-36(31,32)17-7-4-15(24)5-8-17/h4-11,13,21,26-27H,3,12H2,1-2H3,(H,25,30) |
| InChIKey | CFGHYQFQZZKBDZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 161.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|