C22H20ClNO5 — CID 7563990
(6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7563990) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7563990 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)[C@H](C)NC(=O)c3ccc(Cl)cc3)c2cc1C |
| InChI | InChI=1S/C22H20ClNO5/c1-12-8-18-16(10-20(25)29-19(18)9-13(12)2)11-28-22(27)14(3)24-21(26)15-4-6-17(23)7-5-15/h4-10,14H,11H2,1-3H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | GGWLUPQNQKEVMD-AWEZNQCLSA-N |
| XLogP | 3.92 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|