C27H31NO5 — CID 3288481
(7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate (PubChem CID 3288481) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3288481 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1ccc2c(COC(=O)C(NC(=O)c3ccc(C(C)(C)C)cc3)C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C27H31NO5/c1-16(2)24(28-25(30)18-8-10-20(11-9-18)27(4,5)6)26(31)32-15-19-14-23(29)33-22-13-17(3)7-12-21(19)22/h7-14,16,24H,15H2,1-6H3,(H,28,30) |
| InChIKey | IFDZJUBHBOBTBN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|