C23H24N2O5 — CID 41148930
(7-methyl-2-oxochromen-4-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 41148930) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 41148930 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H](NC(=O)Nc3ccccc3)C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H24N2O5/c1-14(2)21(25-23(28)24-17-7-5-4-6-8-17)22(27)29-13-16-12-20(26)30-19-11-15(3)9-10-18(16)19/h4-12,14,21H,13H2,1-3H3,(H2,24,25,28)/t21-/m0/s1 |
| InChIKey | HINWALRBKJBZDM-NRFANRHFSA-N |
| XLogP | 3.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|