C24H25NO6 — CID 55884948
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-benzamido-3-hydroxypropanoate (PubChem CID 55884948) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-benzamido-3-hydroxypropanoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-benzamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 55884948 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-benzamido-3-hydroxypropanoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C(CO)NC(=O)c3ccccc3)c2cc1C(C)C |
| InChI | InChI=1S/C24H25NO6/c1-14(2)18-11-19-17(10-22(27)31-21(19)9-15(18)3)13-30-24(29)20(12-26)25-23(28)16-7-5-4-6-8-16/h4-11,14,20,26H,12-13H2,1-3H3,(H,25,28) |
| InChIKey | UPEXLZZPCXPZPY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|