C30H28O5 — CID 3926946
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(2-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 3926946) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(2-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 3926946 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 3-(2-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | COc1ccccc1C=C(C(=O)OCc1cc(=O)oc2cc(C)c(C(C)C)cc12)c1ccccc1 |
| InChI | InChI=1S/C30H28O5/c1-19(2)24-17-25-23(16-29(31)35-28(25)14-20(24)3)18-34-30(32)26(21-10-6-5-7-11-21)15-22-12-8-9-13-27(22)33-4/h5-17,19H,18H2,1-4H3 |
| InChIKey | ZOWAXVSVTHJWBS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|