C19H12BrNO6 — CID 55310867
(7-bromo-2-oxochromen-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 55310867) has the molecular formula C19H12BrNO6 and a molecular weight of 430.21 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 55310867 |
| Molecular Formula | C19H12BrNO6 |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)OCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C19H12BrNO6/c20-12-5-6-13-11(7-17(22)26-16(13)8-12)10-25-18(23)9-21-14-3-1-2-4-15(14)27-19(21)24/h1-8H,9-10H2 |
| InChIKey | MTTNIINUUKQECN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|