About (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate
(7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate (PubChem CID 55503167) has the molecular formula C21H14BrNO4
and a molecular weight of 424.25 g/mol. Its IUPAC name is (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate.
Molecular Properties
| Compound Name | (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate |
| PubChem CID | 55503167 |
| Molecular Formula | C21H14BrNO4 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate |
| SMILES | O=C(Cc1cccc2cccnc12)OCc1cc(=O)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C21H14BrNO4/c22-16-6-7-17-15(10-20(25)27-18(17)11-16)12-26-19(24)9-14-4-1-3-13-5-2-8-23-21(13)14/h1-8,10-11H,9,12H2 |
| InChIKey | CGOWCABOWYYGID-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate?
The IUPAC name of (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate (CID 55503167) is (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate.
What is the SMILES notation for (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate?
The canonical SMILES for (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate is O=C(Cc1cccc2cccnc12)OCc1cc(=O)oc2cc(Br)ccc12.
What is the InChIKey of (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate?
The InChIKey is CGOWCABOWYYGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BrNO4/c22-16-6-7-17-15(10-20(25)27-18(17)11-16)12-26-19(24)9-14-4-1-3-13-5-2-8-23-21(13)14/h1-8,10-11H,9,12H2.
What are the key properties of (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate?
(7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate has a molecular weight of 424.25 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-bromo-2-oxochromen-4-yl)methyl 2-quinolin-8-ylacetate is sourced from PubChem (CID 55503167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).