C24H19NO5 — CID 16617816
(6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16617816) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16617816 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (6-ethyl-7-hydroxy-2-oxochromen-4-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | CCc1cc2c(COC(=O)/C=C/c3cccc4cccnc34)cc(=O)oc2cc1O |
| InChI | InChI=1S/C24H19NO5/c1-2-15-11-19-18(12-23(28)30-21(19)13-20(15)26)14-29-22(27)9-8-17-6-3-5-16-7-4-10-25-24(16)17/h3-13,26H,2,14H2,1H3/b9-8+ |
| InChIKey | FSUGPARGXGZWEQ-CMDGGOBGSA-N |
| XLogP | 4.37 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|