C18H12N2O6 — CID 7400824
(1,3-dioxoisoindol-2-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7400824) has the molecular formula C18H12N2O6 and a molecular weight of 352.30 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 7400824 |
| Molecular Formula | C18H12N2O6 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12N2O6/c21-15(9-19-13-7-3-4-8-14(13)26-18(19)24)25-10-20-16(22)11-5-1-2-6-12(11)17(20)23/h1-8H,9-10H2 |
| InChIKey | NHWQKHXORBRXQS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|