C9H9N3O3 — CID 44721311
N'-hydroxy-2-(2-oxo-1,3-benzoxazol-3-yl)ethanimidamide (PubChem CID 44721311) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is N'-hydroxy-2-(2-oxo-1,3-benzoxazol-3-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2-oxo-1,3-benzoxazol-3-yl)ethanimidamide |
|---|---|
| PubChem CID | 44721311 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N'-hydroxy-2-(2-oxo-1,3-benzoxazol-3-yl)ethanimidamide |
| SMILES | N/C(Cn1c(=O)oc2ccccc21)=N\O |
| InChI | InChI=1S/C9H9N3O3/c10-8(11-14)5-12-6-3-1-2-4-7(6)15-9(12)13/h1-4,14H,5H2,(H2,10,11) |
| InChIKey | YQBLNMICYQAGMO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|