C16H11Cl2NO4 — CID 7401044
(3,4-dichlorophenyl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7401044) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 7401044 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO4/c17-11-6-5-10(7-12(11)18)9-22-15(20)8-19-13-3-1-2-4-14(13)23-16(19)21/h1-7H,8-9H2 |
| InChIKey | OSMNQILSRKDSEU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |