About (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate
(3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 121403491) has the molecular formula C16H12ClNO5
and a molecular weight of 333.73 g/mol. Its IUPAC name is (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| PubChem CID | 121403491 |
| Molecular Formula | C16H12ClNO5 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2cc(Cl)ccc21)OCc1cccc(O)c1 |
| InChI | InChI=1S/C16H12ClNO5/c17-11-4-5-13-14(7-11)23-16(21)18(13)8-15(20)22-9-10-2-1-3-12(19)6-10/h1-7,19H,8-9H2 |
| InChIKey | ICHKLHIDQQVZRA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate?
The IUPAC name of (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate (CID 121403491) is (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate.
What is the SMILES notation for (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate?
The canonical SMILES for (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate is O=C(Cn1c(=O)oc2cc(Cl)ccc21)OCc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate?
The InChIKey is ICHKLHIDQQVZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO5/c17-11-4-5-13-14(7-11)23-16(21)18(13)8-15(20)22-9-10-2-1-3-12(19)6-10/h1-7,19H,8-9H2.
What are the key properties of (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate?
(3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate has a molecular weight of 333.73 g/mol, XLogP of 2.70, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl)methyl 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetate is sourced from PubChem (CID 121403491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).