C19H16ClNO5 — CID 58485998
ethyl 3-[3-[(6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-2-oxopropanoate (PubChem CID 58485998) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is ethyl 3-[3-[(6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-2-oxopropanoate.
| Compound Name | ethyl 3-[3-[(6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 58485998 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | ethyl 3-[3-[(6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl]phenyl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1cccc(Cn2c(=O)oc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C19H16ClNO5/c1-2-25-18(23)16(22)9-12-4-3-5-13(8-12)11-21-15-7-6-14(20)10-17(15)26-19(21)24/h3-8,10H,2,9,11H2,1H3 |
| InChIKey | SJWCXAQKFICPSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|