C12H10ClNO4 — CID 91982725
(6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl 2-methylprop-2-enoate (PubChem CID 91982725) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is (6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91982725 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (6-chloro-2-oxo-1,3-benzoxazol-3-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H10ClNO4/c1-7(2)11(15)17-6-14-9-4-3-8(13)5-10(9)18-12(14)16/h3-5H,1,6H2,2H3 |
| InChIKey | SRSCJPDPVOYZHY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|