C16H14ClN3O3 — CID 86581111
N-[(3-aminophenyl)methyl]-2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 86581111) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[(3-aminophenyl)methyl]-2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 86581111 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | Nc1cccc(CNC(=O)Cn2c(=O)oc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C16H14ClN3O3/c17-11-4-5-13-14(7-11)23-16(22)20(13)9-15(21)19-8-10-2-1-3-12(18)6-10/h1-7H,8-9,18H2,(H,19,21) |
| InChIKey | KFIDHTHVBOZUJL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|