C17H14ClNO4 — CID 18277911
1-(2-chlorophenyl)ethyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 18277911) has the molecular formula C17H14ClNO4 and a molecular weight of 331.75 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | 1-(2-chlorophenyl)ethyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 18277911 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CC(OC(=O)Cn1c(=O)oc2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClNO4/c1-11(12-6-2-3-7-13(12)18)22-16(20)10-19-14-8-4-5-9-15(14)23-17(19)21/h2-9,11H,10H2,1H3 |
| InChIKey | NKHMRNNHINTIEE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |