C19H16FNO5 — CID 7401131
[4-(4-fluorophenyl)-4-oxobutyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7401131) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 7401131 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)OCCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FNO5/c20-14-9-7-13(8-10-14)16(22)5-3-11-25-18(23)12-21-15-4-1-2-6-17(15)26-19(21)24/h1-2,4,6-10H,3,5,11-12H2 |
| InChIKey | JNIPYFKNAGXMMJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|