C20H16FNO5 — CID 7804513
[4-(4-fluorophenyl)-4-oxobutyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804513) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804513 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)OCCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FNO5/c21-14-9-7-13(8-10-14)17(23)6-3-11-27-18(24)12-22-16-5-2-1-4-15(16)19(25)20(22)26/h1-2,4-5,7-10H,3,6,11-12H2 |
| InChIKey | DRJLEABPXRHZKO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|