C19H14FNO6 — CID 7804310
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 7804310) has the molecular formula C19H14FNO6 and a molecular weight of 371.32 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 7804310 |
| Molecular Formula | C19H14FNO6 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | COc1ccc(F)cc1C(=O)COC(=O)CN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14FNO6/c1-26-16-7-6-11(20)8-13(16)15(22)10-27-17(23)9-21-14-5-3-2-4-12(14)18(24)19(21)25/h2-8H,9-10H2,1H3 |
| InChIKey | NRTDEOKWJQOTOY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|