C20H16FNO6 — CID 46508926
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46508926) has the molecular formula C20H16FNO6 and a molecular weight of 385.35 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46508926 |
| Molecular Formula | C20H16FNO6 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1ccc(F)cc1C(=O)COC(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16FNO6/c1-11(22-18(24)13-5-3-4-6-14(13)19(22)25)20(26)28-10-16(23)15-9-12(21)7-8-17(15)27-2/h3-9,11H,10H2,1-2H3 |
| InChIKey | UPPNZHXSTOQETA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|