C21H21NO7 — CID 9095643
(3,4,5-trimethoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 9095643) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 9095643 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1cc(COC(=O)[C@H](C)N2C(=O)c3ccccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H21NO7/c1-12(22-19(23)14-7-5-6-8-15(14)20(22)24)21(25)29-11-13-9-16(26-2)18(28-4)17(10-13)27-3/h5-10,12H,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | BVWJSNGBXGCUQQ-LBPRGKRZSA-N |
| XLogP | 2.44 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|