C25H28N2O8 — CID 41014657
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 41014657) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 41014657 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | COc1cc(NC(=O)COC(=O)[C@@H](CC(C)C)N2C(=O)c3ccccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N2O8/c1-14(2)10-18(27-23(29)16-8-6-7-9-17(16)24(27)30)25(31)35-13-21(28)26-15-11-19(32-3)22(34-5)20(12-15)33-4/h6-9,11-12,14,18H,10,13H2,1-5H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | JYGFZQAJZMCHJQ-GOSISDBHSA-N |
| XLogP | 2.90 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|