C19H14ClNO6 — CID 24557490
(7-chloro-1,3-benzodioxol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 24557490) has the molecular formula C19H14ClNO6 and a molecular weight of 387.78 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 24557490 |
| Molecular Formula | C19H14ClNO6 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCc1cc(Cl)c2c(c1)OCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14ClNO6/c1-10(21-17(22)12-4-2-3-5-13(12)18(21)23)19(24)25-8-11-6-14(20)16-15(7-11)26-9-27-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | BUHYXWNRSSIZEF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|