C20H15ClO4 — CID 18267753
(7-chloro-1,3-benzodioxol-5-yl)methyl 2-naphthalen-1-ylacetate (PubChem CID 18267753) has the molecular formula C20H15ClO4 and a molecular weight of 354.79 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl 2-naphthalen-1-ylacetate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 18267753 |
| Molecular Formula | C20H15ClO4 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)OCc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H15ClO4/c21-17-8-13(9-18-20(17)25-12-24-18)11-23-19(22)10-15-6-3-5-14-4-1-2-7-16(14)15/h1-9H,10-12H2 |
| InChIKey | PIRSQTAIVNBORT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |