C21H15ClO5 — CID 7603481
(7-chloro-1,3-benzodioxol-5-yl)methyl 3-phenoxybenzoate (PubChem CID 7603481) has the molecular formula C21H15ClO5 and a molecular weight of 382.80 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)methyl 3-phenoxybenzoate.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 3-phenoxybenzoate |
|---|---|
| PubChem CID | 7603481 |
| Molecular Formula | C21H15ClO5 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)methyl 3-phenoxybenzoate |
| SMILES | O=C(OCc1cc(Cl)c2c(c1)OCO2)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H15ClO5/c22-18-9-14(10-19-20(18)26-13-25-19)12-24-21(23)15-5-4-8-17(11-15)27-16-6-2-1-3-7-16/h1-11H,12-13H2 |
| InChIKey | QKRKUMMWNDDFKG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |