C20H14O5 — CID 4565190
1,3-benzodioxol-5-yl 3-phenoxybenzoate (PubChem CID 4565190) has the molecular formula C20H14O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-phenoxybenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-phenoxybenzoate |
|---|---|
| PubChem CID | 4565190 |
| Molecular Formula | C20H14O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-phenoxybenzoate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H14O5/c21-20(25-17-9-10-18-19(12-17)23-13-22-18)14-5-4-8-16(11-14)24-15-6-2-1-3-7-15/h1-12H,13H2 |
| InChIKey | PYJRQWOSZVLUBT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|