C15H12O4S — CID 2561414
1,3-benzodioxol-5-yl 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (PubChem CID 2561414) has the molecular formula C15H12O4S and a molecular weight of 288.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2561414 |
| Molecular Formula | C15H12O4S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C15H12O4S/c16-15(14-6-9-2-1-3-13(9)20-14)19-10-4-5-11-12(7-10)18-8-17-11/h4-7H,1-3,8H2 |
| InChIKey | MNCNCHAFAWQBGS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|