C18H16N2O4S — CID 102560682
[4-[(2,5-dioxoimidazolidin-4-yl)methyl]phenyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (PubChem CID 102560682) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is [4-[(2,5-dioxoimidazolidin-4-yl)methyl]phenyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate.
| Compound Name | [4-[(2,5-dioxoimidazolidin-4-yl)methyl]phenyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102560682 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [4-[(2,5-dioxoimidazolidin-4-yl)methyl]phenyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| SMILES | O=C1NC(=O)C(Cc2ccc(OC(=O)c3cc4c(s3)CCC4)cc2)N1 |
| InChI | InChI=1S/C18H16N2O4S/c21-16-13(19-18(23)20-16)8-10-4-6-12(7-5-10)24-17(22)15-9-11-2-1-3-14(11)25-15/h4-7,9,13H,1-3,8H2,(H2,19,20,21,23) |
| InChIKey | KNBUCKOBFVTXFE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|