C16H13BrO6 — CID 26688614
1,3-benzodioxol-5-yl 4-bromo-3,5-dimethoxybenzoate (PubChem CID 26688614) has the molecular formula C16H13BrO6 and a molecular weight of 381.18 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-bromo-3,5-dimethoxybenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-bromo-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 26688614 |
| Molecular Formula | C16H13BrO6 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-bromo-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc3c(c2)OCO3)cc(OC)c1Br |
| InChI | InChI=1S/C16H13BrO6/c1-19-13-5-9(6-14(20-2)15(13)17)16(18)23-10-3-4-11-12(7-10)22-8-21-11/h3-7H,8H2,1-2H3 |
| InChIKey | GKLDNDZMOOMWIK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|