C17H15BrO6 — CID 7913306
1,3-benzodioxol-5-yl 3-bromo-4-ethoxy-5-methoxybenzoate (PubChem CID 7913306) has the molecular formula C17H15BrO6 and a molecular weight of 395.21 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-bromo-4-ethoxy-5-methoxybenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-bromo-4-ethoxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7913306 |
| Molecular Formula | C17H15BrO6 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-bromo-4-ethoxy-5-methoxybenzoate |
| SMILES | CCOc1c(Br)cc(C(=O)Oc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C17H15BrO6/c1-3-21-16-12(18)6-10(7-15(16)20-2)17(19)24-11-4-5-13-14(8-11)23-9-22-13/h4-8H,3,9H2,1-2H3 |
| InChIKey | CTYYFVRVWYAOCQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|