C18H18BrNO5 — CID 4786325
N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-5-ethoxy-4-methoxybenzamide (PubChem CID 4786325) has the molecular formula C18H18BrNO5 and a molecular weight of 408.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-5-ethoxy-4-methoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-5-ethoxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 4786325 |
| Molecular Formula | C18H18BrNO5 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-5-ethoxy-4-methoxybenzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccc3c(c2)OCO3)cc(Br)c1OC |
| InChI | InChI=1S/C18H18BrNO5/c1-3-23-16-8-12(7-13(19)17(16)22-2)18(21)20-9-11-4-5-14-15(6-11)25-10-24-14/h4-8H,3,9-10H2,1-2H3,(H,20,21) |
| InChIKey | SKLVXENJUCTMQJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |