C23H25NO7 — CID 4826965
1,3-benzodioxol-5-yl 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate (PubChem CID 4826965) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate |
|---|---|
| PubChem CID | 4826965 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc3c(c2)OCO3)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H25NO7/c1-2-27-20-12-16(23(26)31-17-7-9-19-21(13-17)30-15-29-19)6-8-18(20)28-14-22(25)24-10-4-3-5-11-24/h6-9,12-13H,2-5,10-11,14-15H2,1H3 |
| InChIKey | ZHHRXURRRZFRIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|