C25H28N2O6 — CID 55336527
(4-cyano-2-ethoxyphenyl) 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate (PubChem CID 55336527) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate.
| Compound Name | (4-cyano-2-ethoxyphenyl) 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate |
|---|---|
| PubChem CID | 55336527 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc(C#N)cc2OCC)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H28N2O6/c1-3-30-22-14-18(16-26)8-10-21(22)33-25(29)19-9-11-20(23(15-19)31-4-2)32-17-24(28)27-12-6-5-7-13-27/h8-11,14-15H,3-7,12-13,17H2,1-2H3 |
| InChIKey | XZGOHWMMFCCIKK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|