C16H19N3O4 — CID 56799844
3-ethoxy-4-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethoxy]benzonitrile (PubChem CID 56799844) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-ethoxy-4-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethoxy]benzonitrile.
| Compound Name | 3-ethoxy-4-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 56799844 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-ethoxy-4-[2-oxo-2-(5-oxo-1,4-diazepan-1-yl)ethoxy]benzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C16H19N3O4/c1-2-22-14-9-12(10-17)3-4-13(14)23-11-16(21)19-7-5-15(20)18-6-8-19/h3-4,9H,2,5-8,11H2,1H3,(H,18,20) |
| InChIKey | HESZJDBZTZXUFT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |