C14H15N3O4 — CID 51074220
3-methoxy-4-[2-oxo-2-(3-oxopiperazin-1-yl)ethoxy]benzonitrile (PubChem CID 51074220) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-methoxy-4-[2-oxo-2-(3-oxopiperazin-1-yl)ethoxy]benzonitrile.
| Compound Name | 3-methoxy-4-[2-oxo-2-(3-oxopiperazin-1-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 51074220 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-methoxy-4-[2-oxo-2-(3-oxopiperazin-1-yl)ethoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C14H15N3O4/c1-20-12-6-10(7-15)2-3-11(12)21-9-14(19)17-5-4-16-13(18)8-17/h2-3,6H,4-5,8-9H2,1H3,(H,16,18) |
| InChIKey | GAAIDDCZGPDKLE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |