C20H20ClN3O5S — CID 2548087
4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]-3-methoxybenzonitrile (PubChem CID 2548087) has the molecular formula C20H20ClN3O5S and a molecular weight of 449.92 g/mol. Its IUPAC name is 4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]-3-methoxybenzonitrile.
| Compound Name | 4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 2548087 |
| Molecular Formula | C20H20ClN3O5S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 4-[2-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethoxy]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H20ClN3O5S/c1-28-19-12-15(13-22)2-7-18(19)29-14-20(25)23-8-10-24(11-9-23)30(26,27)17-5-3-16(21)4-6-17/h2-7,12H,8-11,14H2,1H3 |
| InChIKey | IRVGPOBMSHMQST-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |