C23H25N3O4 — CID 32627711
2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]acetamide (PubChem CID 32627711) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 32627711 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)NCc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H25N3O4/c1-2-29-21-13-18(14-24)7-10-20(21)30-16-22(27)25-15-17-5-8-19(9-6-17)23(28)26-11-3-4-12-26/h5-10,13H,2-4,11-12,15-16H2,1H3,(H,25,27) |
| InChIKey | ZFWNQLLIRQIXDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |