C18H16Cl2N2O3 — CID 7992879
2-(4-cyano-2-ethoxyphenoxy)-N-[(2,4-dichlorophenyl)methyl]acetamide (PubChem CID 7992879) has the molecular formula C18H16Cl2N2O3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-[(2,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[(2,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 7992879 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[(2,4-dichlorophenyl)methyl]acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-2-24-17-7-12(9-21)3-6-16(17)25-11-18(23)22-10-13-4-5-14(19)8-15(13)20/h3-8H,2,10-11H2,1H3,(H,22,23) |
| InChIKey | HRPPFZIGRPQDKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |