C17H13F3N2O3 — CID 7993287
2-(4-cyano-2-ethoxyphenoxy)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7993287) has the molecular formula C17H13F3N2O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7993287 |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3N2O3/c1-2-24-14-7-10(8-21)3-6-13(14)25-9-15(23)22-12-5-4-11(18)16(19)17(12)20/h3-7H,2,9H2,1H3,(H,22,23) |
| InChIKey | NYZWNBMNADREQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|