C16H14ClN3O3 — CID 7992846
N-(2-chloro-3-pyridinyl)-2-(4-cyano-2-ethoxyphenoxy)acetamide (PubChem CID 7992846) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(4-cyano-2-ethoxyphenoxy)acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(4-cyano-2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7992846 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(4-cyano-2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H14ClN3O3/c1-2-22-14-8-11(9-18)5-6-13(14)23-10-15(21)20-12-4-3-7-19-16(12)17/h3-8H,2,10H2,1H3,(H,20,21) |
| InChIKey | PEFYWGMCLYNZCD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|