C19H21Cl2NO4 — CID 99993644
2-(2,4-dichlorophenoxy)-N-[(3,4-diethoxyphenyl)methyl]acetamide (PubChem CID 99993644) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(3,4-diethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-diethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 99993644 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-diethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccc(CNC(=O)COc2ccc(Cl)cc2Cl)cc1OCC |
| InChI | InChI=1S/C19H21Cl2NO4/c1-3-24-17-7-5-13(9-18(17)25-4-2)11-22-19(23)12-26-16-8-6-14(20)10-15(16)21/h5-10H,3-4,11-12H2,1-2H3,(H,22,23) |
| InChIKey | DFIUKYJCXIGBNA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |