C18H17BrO6 — CID 7741505
1,3-benzodioxol-5-yl 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 7741505) has the molecular formula C18H17BrO6 and a molecular weight of 409.23 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 7741505 |
| Molecular Formula | C18H17BrO6 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)Oc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C18H17BrO6/c1-3-6-22-17-13(19)7-11(8-16(17)21-2)18(20)25-12-4-5-14-15(9-12)24-10-23-14/h4-5,7-9H,3,6,10H2,1-2H3 |
| InChIKey | QINFGQHQZCWHFZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|