C22H21BrN2O5 — CID 51138298
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 51138298) has the molecular formula C22H21BrN2O5 and a molecular weight of 473.32 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 51138298 |
| Molecular Formula | C22H21BrN2O5 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-bromo-5-methoxy-4-propoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCOc1c(Br)cc(/C=C(\C#N)C(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C22H21BrN2O5/c1-3-6-28-21-17(23)8-15(10-20(21)27-2)7-16(11-24)22(26)25-12-14-4-5-18-19(9-14)30-13-29-18/h4-5,7-10H,3,6,12-13H2,1-2H3,(H,25,26)/b16-7+ |
| InChIKey | YXHGRENFYHQFKB-FRKPEAEDSA-N |
| XLogP | 4.20 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|