C18H13BrN2O3 — CID 17280259
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-bromophenyl)-2-cyanoprop-2-enamide (PubChem CID 17280259) has the molecular formula C18H13BrN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-bromophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-bromophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 17280259 |
| Molecular Formula | C18H13BrN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-bromophenyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Br)cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13BrN2O3/c19-15-4-1-12(2-5-15)7-14(9-20)18(22)21-10-13-3-6-16-17(8-13)24-11-23-16/h1-8H,10-11H2,(H,21,22)/b14-7+ |
| InChIKey | DSLWZUQSHRIAIH-VGOFMYFVSA-N |
| XLogP | 3.40 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|