C16H14O4S — CID 8777258
1,3-benzodioxol-5-yl 3-(methylsulfanylmethyl)benzoate (PubChem CID 8777258) has the molecular formula C16H14O4S and a molecular weight of 302.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(methylsulfanylmethyl)benzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(methylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 8777258 |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(methylsulfanylmethyl)benzoate |
| SMILES | CSCc1cccc(C(=O)Oc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C16H14O4S/c1-21-9-11-3-2-4-12(7-11)16(17)20-13-5-6-14-15(8-13)19-10-18-14/h2-8H,9-10H2,1H3 |
| InChIKey | LYIRAOOSONTARY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|