C17H17NO6S — CID 17443994
1,3-benzodioxol-5-yl 3-(propan-2-ylsulfamoyl)benzoate (PubChem CID 17443994) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 17443994 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)Oc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H17NO6S/c1-11(2)18-25(20,21)14-5-3-4-12(8-14)17(19)24-13-6-7-15-16(9-13)23-10-22-15/h3-9,11,18H,10H2,1-2H3 |
| InChIKey | WJXLOGNIXYNQTR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|