C19H17NO6S — CID 90576329
3-acetyl-N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]benzenesulfonamide (PubChem CID 90576329) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is 3-acetyl-N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90576329 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-acetyl-N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCC#CCOc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H17NO6S/c1-14(21)15-5-4-6-17(11-15)27(22,23)20-9-2-3-10-24-16-7-8-18-19(12-16)26-13-25-18/h4-8,11-12,20H,9-10,13H2,1H3 |
| InChIKey | OPVWTKWEHAQCRZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|