C13H10F3NO4 — CID 90576250
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 90576250) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90576250 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC#CCOc1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NO4/c14-13(15,16)12(18)17-5-1-2-6-19-9-3-4-10-11(7-9)21-8-20-10/h3-4,7H,5-6,8H2,(H,17,18) |
| InChIKey | ANCYHVIJMCOKEJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|