C19H14N2O4 — CID 71803149
N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-cyanobenzamide (PubChem CID 71803149) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-cyanobenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 71803149 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yloxy)but-2-ynyl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)NCC#CCOc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C19H14N2O4/c20-12-14-4-3-5-15(10-14)19(22)21-8-1-2-9-23-16-6-7-17-18(11-16)25-13-24-17/h3-7,10-11H,8-9,13H2,(H,21,22) |
| InChIKey | MPGBKJHMZQYPEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|